C6H5N5S2 — CID 54237438
N-(1H-imidazol-2-yl)-1,2,5-thiadiazole-3-carbothioamide (PubChem CID 54237438) has the molecular formula C6H5N5S2 and a molecular weight of 211.28 g/mol. Its IUPAC name is N-(1H-imidazol-2-yl)-1,2,5-thiadiazole-3-carbothioamide.
| Compound Name | N-(1H-imidazol-2-yl)-1,2,5-thiadiazole-3-carbothioamide |
|---|---|
| PubChem CID | 54237438 |
| Molecular Formula | C6H5N5S2 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | N-(1H-imidazol-2-yl)-1,2,5-thiadiazole-3-carbothioamide |
| SMILES | S=C(Nc1ncc[nH]1)c1cnsn1 |
| InChI | InChI=1S/C6H5N5S2/c12-5(4-3-9-13-11-4)10-6-7-1-2-8-6/h1-3H,(H2,7,8,10,12) |
| InChIKey | QNOHAHYWECWCKC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|