C10H20N2O3 — CID 54237477
ethyl (3S,4R)-4-amino-3-ethoxypiperidine-1-carboxylate (PubChem CID 54237477) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is ethyl (3S,4R)-4-amino-3-ethoxypiperidine-1-carboxylate.
| Compound Name | ethyl (3S,4R)-4-amino-3-ethoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 54237477 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | ethyl (3S,4R)-4-amino-3-ethoxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC[C@@H](N)[C@@H](OCC)C1 |
| InChI | InChI=1S/C10H20N2O3/c1-3-14-9-7-12(6-5-8(9)11)10(13)15-4-2/h8-9H,3-7,11H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | QNOZFBCSHIRSJN-BDAKNGLRSA-N |
| XLogP | 0.58 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |