C13H24N2 — CID 54237489
2-methyl-N-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)propan-1-imine (PubChem CID 54237489) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 2-methyl-N-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)propan-1-imine.
| Compound Name | 2-methyl-N-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)propan-1-imine |
|---|---|
| PubChem CID | 54237489 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 2-methyl-N-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)propan-1-imine |
| SMILES | CC(C)/C=N/C1=CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C13H24N2/c1-10(2)9-14-11-7-12(3,4)15-13(5,6)8-11/h7,9-10,15H,8H2,1-6H3/b14-9+ |
| InChIKey | QNPCDYPFUHBFDK-NTEUORMPSA-N |
| XLogP | 3.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|