About 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid
4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid (PubChem CID 54237645) has the molecular formula C20H22NO5P
and a molecular weight of 387.37 g/mol. Its IUPAC name is 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid |
| PubChem CID | 54237645 |
| Molecular Formula | C20H22NO5P |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid |
| SMILES | O=PC(O)(Cc1ccccc1)[C@H]1CN[C@H](Cc2ccc(C(=O)O)cc2)CO1 |
| InChI | InChI=1S/C20H22NO5P/c22-19(23)16-8-6-14(7-9-16)10-17-13-26-18(12-21-17)20(24,27-25)11-15-4-2-1-3-5-15/h1-9,17-18,21,24H,10-13H2,(H,22,23)/t17-,18-,20?/m1/s1 |
| InChIKey | XYYUBSHLPMTSOR-KUBVQFIISA-N |
| XLogP | 2.51 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid?
The IUPAC name of 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid (CID 54237645) is 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid.
What is the SMILES notation for 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid?
The canonical SMILES for 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid is O=PC(O)(Cc1ccccc1)[C@H]1CN[C@H](Cc2ccc(C(=O)O)cc2)CO1.
What is the InChIKey of 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid?
The InChIKey is XYYUBSHLPMTSOR-KUBVQFIISA-N. The full InChI is InChI=1S/C20H22NO5P/c22-19(23)16-8-6-14(7-9-16)10-17-13-26-18(12-21-17)20(24,27-25)11-15-4-2-1-3-5-15/h1-9,17-18,21,24H,10-13H2,(H,22,23)/t17-,18-,20?/m1/s1.
What are the key properties of 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid?
4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid has a molecular weight of 387.37 g/mol, XLogP of 2.51, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3R,6R)-6-(1-hydroxy-2-phenyl-1-phosphorosoethyl)morpholin-3-yl]methyl]benzoic acid is sourced from PubChem (CID 54237645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).