About 1,2-dimethylimidazole-4,5-diol
1,2-dimethylimidazole-4,5-diol (PubChem CID 54237963) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 1,2-dimethylimidazole-4,5-diol.
Molecular Properties
| Compound Name | 1,2-dimethylimidazole-4,5-diol |
| PubChem CID | 54237963 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 1,2-dimethylimidazole-4,5-diol |
| SMILES | Cc1nc(O)c(O)n1C |
| InChI | InChI=1S/C5H8N2O2/c1-3-6-4(8)5(9)7(3)2/h8-9H,1-2H3 |
| InChIKey | QNXNTXYFRSFDED-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-dimethylimidazole-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylimidazole-4,5-diol?
The IUPAC name of 1,2-dimethylimidazole-4,5-diol (CID 54237963) is 1,2-dimethylimidazole-4,5-diol.
What is the SMILES notation for 1,2-dimethylimidazole-4,5-diol?
The canonical SMILES for 1,2-dimethylimidazole-4,5-diol is Cc1nc(O)c(O)n1C.
What is the InChIKey of 1,2-dimethylimidazole-4,5-diol?
The InChIKey is QNXNTXYFRSFDED-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-3-6-4(8)5(9)7(3)2/h8-9H,1-2H3.
What are the key properties of 1,2-dimethylimidazole-4,5-diol?
1,2-dimethylimidazole-4,5-diol has a molecular weight of 128.13 g/mol, XLogP of 0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylimidazole-4,5-diol is sourced from PubChem (CID 54237963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).