C13H22O — CID 54238174
4,4,6a-trimethyl-3-prop-1-enyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan (PubChem CID 54238174) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 4,4,6a-trimethyl-3-prop-1-enyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan.
| Compound Name | 4,4,6a-trimethyl-3-prop-1-enyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan |
|---|---|
| PubChem CID | 54238174 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 4,4,6a-trimethyl-3-prop-1-enyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan |
| SMILES | CC=CC1OCC2(C)CCC(C)(C)C12 |
| InChI | InChI=1S/C13H22O/c1-5-6-10-11-12(2,3)7-8-13(11,4)9-14-10/h5-6,10-11H,7-9H2,1-4H3 |
| InChIKey | QOBJRANWINLRNX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|