About methyl thiophene-2-sulfinate
methyl thiophene-2-sulfinate (PubChem CID 54238508) has the molecular formula C5H6O2S2
and a molecular weight of 162.23 g/mol. Its IUPAC name is methyl thiophene-2-sulfinate.
Molecular Properties
| Compound Name | methyl thiophene-2-sulfinate |
| PubChem CID | 54238508 |
| Molecular Formula | C5H6O2S2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 161.98 |
| IUPAC Name | methyl thiophene-2-sulfinate |
| SMILES | COS(=O)c1cccs1 |
| InChI | InChI=1S/C5H6O2S2/c1-7-9(6)5-3-2-4-8-5/h2-4H,1H3 |
| InChIKey | QOHLEXPTCVVODW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl thiophene-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl thiophene-2-sulfinate?
The IUPAC name of methyl thiophene-2-sulfinate (CID 54238508) is methyl thiophene-2-sulfinate.
What is the SMILES notation for methyl thiophene-2-sulfinate?
The canonical SMILES for methyl thiophene-2-sulfinate is COS(=O)c1cccs1.
What is the InChIKey of methyl thiophene-2-sulfinate?
The InChIKey is QOHLEXPTCVVODW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O2S2/c1-7-9(6)5-3-2-4-8-5/h2-4H,1H3.
What are the key properties of methyl thiophene-2-sulfinate?
methyl thiophene-2-sulfinate has a molecular weight of 162.23 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl thiophene-2-sulfinate is sourced from PubChem (CID 54238508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).