About 4-(1,3,5-triazin-2-yl)-1,2-oxazole
4-(1,3,5-triazin-2-yl)-1,2-oxazole (PubChem CID 54238777) has the molecular formula C6H4N4O
and a molecular weight of 148.12 g/mol. Its IUPAC name is 4-(1,3,5-triazin-2-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 4-(1,3,5-triazin-2-yl)-1,2-oxazole |
| PubChem CID | 54238777 |
| Molecular Formula | C6H4N4O |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 4-(1,3,5-triazin-2-yl)-1,2-oxazole |
| SMILES | c1ncnc(-c2cnoc2)n1 |
| InChI | InChI=1S/C6H4N4O/c1-5(2-11-10-1)6-8-3-7-4-9-6/h1-4H |
| InChIKey | KLSVPULWAAWCKY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,3,5-triazin-2-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3,5-triazin-2-yl)-1,2-oxazole?
The IUPAC name of 4-(1,3,5-triazin-2-yl)-1,2-oxazole (CID 54238777) is 4-(1,3,5-triazin-2-yl)-1,2-oxazole.
What is the SMILES notation for 4-(1,3,5-triazin-2-yl)-1,2-oxazole?
The canonical SMILES for 4-(1,3,5-triazin-2-yl)-1,2-oxazole is c1ncnc(-c2cnoc2)n1.
What is the InChIKey of 4-(1,3,5-triazin-2-yl)-1,2-oxazole?
The InChIKey is KLSVPULWAAWCKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O/c1-5(2-11-10-1)6-8-3-7-4-9-6/h1-4H.
What are the key properties of 4-(1,3,5-triazin-2-yl)-1,2-oxazole?
4-(1,3,5-triazin-2-yl)-1,2-oxazole has a molecular weight of 148.12 g/mol, XLogP of 0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3,5-triazin-2-yl)-1,2-oxazole is sourced from PubChem (CID 54238777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).