About 1,2,3,4-tetramethoxybutane
1,2,3,4-tetramethoxybutane (PubChem CID 542388) has the molecular formula C8H18O4
and a molecular weight of 178.23 g/mol. Its IUPAC name is 1,2,3,4-tetramethoxybutane.
Molecular Properties
| Compound Name | 1,2,3,4-tetramethoxybutane |
| PubChem CID | 542388 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1,2,3,4-tetramethoxybutane |
| SMILES | COCC(OC)C(COC)OC |
| InChI | InChI=1S/C8H18O4/c1-9-5-7(11-3)8(12-4)6-10-2/h7-8H,5-6H2,1-4H3 |
| InChIKey | UOTINMFZLVZNEW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2,3,4-tetramethoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetramethoxybutane?
The IUPAC name of 1,2,3,4-tetramethoxybutane (CID 542388) is 1,2,3,4-tetramethoxybutane.
What is the SMILES notation for 1,2,3,4-tetramethoxybutane?
The canonical SMILES for 1,2,3,4-tetramethoxybutane is COCC(OC)C(COC)OC.
What is the InChIKey of 1,2,3,4-tetramethoxybutane?
The InChIKey is UOTINMFZLVZNEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O4/c1-9-5-7(11-3)8(12-4)6-10-2/h7-8H,5-6H2,1-4H3.
What are the key properties of 1,2,3,4-tetramethoxybutane?
1,2,3,4-tetramethoxybutane has a molecular weight of 178.23 g/mol, XLogP of 0.31, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetramethoxybutane is sourced from PubChem (CID 542388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).