About 2-ethylhexylthiourea
2-ethylhexylthiourea (PubChem CID 54238983) has the molecular formula C9H20N2S
and a molecular weight of 188.34 g/mol. Its IUPAC name is 2-ethylhexylthiourea.
Molecular Properties
| Compound Name | 2-ethylhexylthiourea |
| PubChem CID | 54238983 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-ethylhexylthiourea |
| SMILES | CCCCC(CC)CNC(N)=S |
| InChI | InChI=1S/C9H20N2S/c1-3-5-6-8(4-2)7-11-9(10)12/h8H,3-7H2,1-2H3,(H3,10,11,12) |
| InChIKey | QOQKMMGDQNWDOD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexylthiourea?
The IUPAC name of 2-ethylhexylthiourea (CID 54238983) is 2-ethylhexylthiourea.
What is the SMILES notation for 2-ethylhexylthiourea?
The canonical SMILES for 2-ethylhexylthiourea is CCCCC(CC)CNC(N)=S.
What is the InChIKey of 2-ethylhexylthiourea?
The InChIKey is QOQKMMGDQNWDOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2S/c1-3-5-6-8(4-2)7-11-9(10)12/h8H,3-7H2,1-2H3,(H3,10,11,12).
What are the key properties of 2-ethylhexylthiourea?
2-ethylhexylthiourea has a molecular weight of 188.34 g/mol, XLogP of 2.04, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexylthiourea is sourced from PubChem (CID 54238983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).