C28H42O4S — CID 54240034
5-methoxy-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraen-1-ol (PubChem CID 54240034) has the molecular formula C28H42O4S and a molecular weight of 474.71 g/mol. Its IUPAC name is 5-methoxy-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraen-1-ol.
| Compound Name | 5-methoxy-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraen-1-ol |
|---|---|
| PubChem CID | 54240034 |
| Molecular Formula | C28H42O4S |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 5-methoxy-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraen-1-ol |
| SMILES | COC(C=C(C)CC(C=C(C)CCC=C(C)C)S(=O)(=O)c1ccc(C)cc1)CC(C)=CCO |
| InChI | InChI=1S/C28H42O4S/c1-21(2)9-8-10-23(4)19-28(33(30,31)27-13-11-22(3)12-14-27)20-25(6)18-26(32-7)17-24(5)15-16-29/h9,11-15,18-19,26,28-29H,8,10,16-17,20H2,1-7H3 |
| InChIKey | QPJDPUAFZMMKPY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|