About 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione
6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione (PubChem CID 54240221) has the molecular formula C11H4ClF3N2O5
and a molecular weight of 336.61 g/mol. Its IUPAC name is 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione.
Molecular Properties
| Compound Name | 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione |
| PubChem CID | 54240221 |
| Molecular Formula | C11H4ClF3N2O5 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione |
| SMILES | O=c1cc(O)c2c(Cl)c([N+](=O)[O-])c(C(F)(F)F)cc2[nH]c1=O |
| InChI | InChI=1S/C11H4ClF3N2O5/c12-8-7-4(16-10(20)6(19)2-5(7)18)1-3(11(13,14)15)9(8)17(21)22/h1-2,18H,(H,16,19,20) |
| InChIKey | QPMJDHNDZDQJBZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione?
The IUPAC name of 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione (CID 54240221) is 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione.
What is the SMILES notation for 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione?
The canonical SMILES for 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione is O=c1cc(O)c2c(Cl)c([N+](=O)[O-])c(C(F)(F)F)cc2[nH]c1=O.
What is the InChIKey of 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione?
The InChIKey is QPMJDHNDZDQJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H4ClF3N2O5/c12-8-7-4(16-10(20)6(19)2-5(7)18)1-3(11(13,14)15)9(8)17(21)22/h1-2,18H,(H,16,19,20).
What are the key properties of 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione?
6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione has a molecular weight of 336.61 g/mol, XLogP of 2.17, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-hydroxy-7-nitro-8-(trifluoromethyl)-1H-1-benzazepine-2,3-dione is sourced from PubChem (CID 54240221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).