C20H23F3N2O — CID 54240543
(2S,3S)-N-benzyl-2-phenyl-N-(2,2,2-trifluoroethoxy)piperidin-3-amine (PubChem CID 54240543) has the molecular formula C20H23F3N2O and a molecular weight of 364.41 g/mol. Its IUPAC name is (2S,3S)-N-benzyl-2-phenyl-N-(2,2,2-trifluoroethoxy)piperidin-3-amine.
| Compound Name | (2S,3S)-N-benzyl-2-phenyl-N-(2,2,2-trifluoroethoxy)piperidin-3-amine |
|---|---|
| PubChem CID | 54240543 |
| Molecular Formula | C20H23F3N2O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (2S,3S)-N-benzyl-2-phenyl-N-(2,2,2-trifluoroethoxy)piperidin-3-amine |
| SMILES | FC(F)(F)CON(Cc1ccccc1)[C@H]1CCCN[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H23F3N2O/c21-20(22,23)15-26-25(14-16-8-3-1-4-9-16)18-12-7-13-24-19(18)17-10-5-2-6-11-17/h1-6,8-11,18-19,24H,7,12-15H2/t18-,19-/m0/s1 |
| InChIKey | QPRNXKOTSCFKOZ-OALUTQOASA-N |
| XLogP | 4.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|