C12H17NO3 — CID 54240555
2-[2-(oxiran-2-yl)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54240555) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-[2-(oxiran-2-yl)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[2-(oxiran-2-yl)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54240555 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-[2-(oxiran-2-yl)ethyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CCC1CO1)CCCC2 |
| InChI | InChI=1S/C12H17NO3/c14-11-9-3-1-2-4-10(9)12(15)13(11)6-5-8-7-16-8/h8,14-15H,1-7H2 |
| InChIKey | QPRRDHZODJGDAQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|