C19H18F5N3O6S — CID 54241208
(2,5-dihydroxypyrrol-1-yl) 2-[[(2S)-2-methyl-4-methylsulfanyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoyl]amino]acetate (PubChem CID 54241208) has the molecular formula C19H18F5N3O6S and a molecular weight of 511.43 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[[(2S)-2-methyl-4-methylsulfanyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoyl]amino]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[[(2S)-2-methyl-4-methylsulfanyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoyl]amino]acetate |
|---|---|
| PubChem CID | 54241208 |
| Molecular Formula | C19H18F5N3O6S |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[[(2S)-2-methyl-4-methylsulfanyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoyl]amino]acetate |
| SMILES | CSCC[C@](C)(NC(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)NCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C19H18F5N3O6S/c1-19(5-6-34-2,18(32)25-7-10(30)33-27-8(28)3-4-9(27)29)26-17(31)11-12(20)14(22)16(24)15(23)13(11)21/h3-4,28-29H,5-7H2,1-2H3,(H,25,32)(H,26,31)/t19-/m0/s1 |
| InChIKey | QQDHZMROXDFGEK-IBGZPJMESA-N |
| XLogP | 1.61 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|