C27H29N3O3 — CID 54241630
N,N-diethyl-4-[[6-[2-(1H-imidazol-5-yl)ethoxy]-1-oxo-3,4-dihydronaphthalen-2-ylidene]methyl]benzamide (PubChem CID 54241630) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N,N-diethyl-4-[[6-[2-(1H-imidazol-5-yl)ethoxy]-1-oxo-3,4-dihydronaphthalen-2-ylidene]methyl]benzamide.
| Compound Name | N,N-diethyl-4-[[6-[2-(1H-imidazol-5-yl)ethoxy]-1-oxo-3,4-dihydronaphthalen-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 54241630 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N,N-diethyl-4-[[6-[2-(1H-imidazol-5-yl)ethoxy]-1-oxo-3,4-dihydronaphthalen-2-ylidene]methyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C=C2CCc3cc(OCCc4cnc[nH]4)ccc3C2=O)cc1 |
| InChI | InChI=1S/C27H29N3O3/c1-3-30(4-2)27(32)20-7-5-19(6-8-20)15-22-10-9-21-16-24(11-12-25(21)26(22)31)33-14-13-23-17-28-18-29-23/h5-8,11-12,15-18H,3-4,9-10,13-14H2,1-2H3,(H,28,29) |
| InChIKey | QQKNZLDBKILHBE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|