About 2-methylpropylhydrazine
2-methylpropylhydrazine (PubChem CID 542420) has the molecular formula C4H12N2
and a molecular weight of 88.15 g/mol. Its IUPAC name is 2-methylpropylhydrazine.
Molecular Properties
| Compound Name | 2-methylpropylhydrazine |
| PubChem CID | 542420 |
| Molecular Formula | C4H12N2 |
| Molecular Weight | 88.15 g/mol |
| Exact Mass | 88.10 |
| IUPAC Name | 2-methylpropylhydrazine |
| SMILES | CC(C)CNN |
| InChI | InChI=1S/C4H12N2/c1-4(2)3-6-5/h4,6H,3,5H2,1-2H3 |
| InChIKey | NGSOWKPBNFOQCR-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropylhydrazine?
The IUPAC name of 2-methylpropylhydrazine (CID 542420) is 2-methylpropylhydrazine.
What is the SMILES notation for 2-methylpropylhydrazine?
The canonical SMILES for 2-methylpropylhydrazine is CC(C)CNN.
What is the InChIKey of 2-methylpropylhydrazine?
The InChIKey is NGSOWKPBNFOQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2/c1-4(2)3-6-5/h4,6H,3,5H2,1-2H3.
What are the key properties of 2-methylpropylhydrazine?
2-methylpropylhydrazine has a molecular weight of 88.15 g/mol, XLogP of 0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropylhydrazine is sourced from PubChem (CID 542420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).