C84H124O8P2S — CID 54242161
[4-(4-dihydroxyphosphanyloxyphenyl)sulfonyl-2,3,5,6-tetrakis(2,4,6-tritert-butylphenyl)phenyl] dihydrogen phosphite (PubChem CID 54242161) has the molecular formula C84H124O8P2S and a molecular weight of 1355.92 g/mol. Its IUPAC name is [4-(4-dihydroxyphosphanyloxyphenyl)sulfonyl-2,3,5,6-tetrakis(2,4,6-tritert-butylphenyl)phenyl] dihydrogen phosphite.
| Compound Name | [4-(4-dihydroxyphosphanyloxyphenyl)sulfonyl-2,3,5,6-tetrakis(2,4,6-tritert-butylphenyl)phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 54242161 |
| Molecular Formula | C84H124O8P2S |
| Molecular Weight | 1355.92 g/mol |
| Exact Mass | 1354.85 |
| IUPAC Name | [4-(4-dihydroxyphosphanyloxyphenyl)sulfonyl-2,3,5,6-tetrakis(2,4,6-tritert-butylphenyl)phenyl] dihydrogen phosphite |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(-c2c(OP(O)O)c(-c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)c(-c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)c(S(=O)(=O)c3ccc(OP(O)O)cc3)c2-c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C84H124O8P2S/c1-73(2,3)49-41-55(77(13,14)15)63(56(42-49)78(16,17)18)67-69(65-59(81(25,26)27)45-51(75(7,8)9)46-60(65)82(28,29)30)72(95(89,90)54-39-37-53(38-40-54)91-93(85)86)70(66-61(83(31,32)33)47-52(76(10,11)12)48-62(66)84(34,35)36)68(71(67)92-94(87)88)64-57(79(19,20)21)43-50(74(4,5)6)44-58(64)80(22,23)24/h37-48,85-88H,1-36H3 |
| InChIKey | QQTLCGVZONVYHT-UHFFFAOYSA-N |
| XLogP | 23.94 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 95 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1355.92 |
| LogP ≤ 5 | 23.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|