About (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate
(3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate (PubChem CID 54242410) has the molecular formula C23H25N3O5
and a molecular weight of 423.47 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate.
Molecular Properties
| Compound Name | (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate |
| PubChem CID | 54242410 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate |
| SMILES | CCCCOc1cc(=NC(=O)Oc2cc(OC)cc(OC)c2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C23H25N3O5/c1-4-5-11-30-22-12-17(16-24-26(22)18-9-7-6-8-10-18)25-23(27)31-21-14-19(28-2)13-20(15-21)29-3/h6-10,12-16H,4-5,11H2,1-3H3 |
| InChIKey | QQYBGHSNNBECIS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate?
The IUPAC name of (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate (CID 54242410) is (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate.
What is the SMILES notation for (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate?
The canonical SMILES for (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate is CCCCOc1cc(=NC(=O)Oc2cc(OC)cc(OC)c2)cnn1-c1ccccc1.
What is the InChIKey of (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate?
The InChIKey is QQYBGHSNNBECIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O5/c1-4-5-11-30-22-12-17(16-24-26(22)18-9-7-6-8-10-18)25-23(27)31-21-14-19(28-2)13-20(15-21)29-3/h6-10,12-16H,4-5,11H2,1-3H3.
What are the key properties of (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate?
(3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate has a molecular weight of 423.47 g/mol, XLogP of 4.17, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethoxyphenyl) N-(6-butoxy-1-phenylpyridazin-4-ylidene)carbamate is sourced from PubChem (CID 54242410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).