C8H16N2O — CID 54242718
(4aR,7aR)-4,6-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 54242718) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (4aR,7aR)-4,6-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aR)-4,6-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 54242718 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (4aR,7aR)-4,6-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | CN1C[C@@H]2[C@@H](C1)OCCN2C |
| InChI | InChI=1S/C8H16N2O/c1-9-5-7-8(6-9)11-4-3-10(7)2/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | QRDFOUXMBAVDIZ-HTQZYQBOSA-N |
| XLogP | -0.37 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |