About 2-(N-propan-2-ylanilino)ethane-1,1,1-triol
2-(N-propan-2-ylanilino)ethane-1,1,1-triol (PubChem CID 54242870) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-(N-propan-2-ylanilino)ethane-1,1,1-triol.
Molecular Properties
| Compound Name | 2-(N-propan-2-ylanilino)ethane-1,1,1-triol |
| PubChem CID | 54242870 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-(N-propan-2-ylanilino)ethane-1,1,1-triol |
| SMILES | CC(C)N(CC(O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C11H17NO3/c1-9(2)12(8-11(13,14)15)10-6-4-3-5-7-10/h3-7,9,13-15H,8H2,1-2H3 |
| InChIKey | QRFRPAOUPOJJPG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(N-propan-2-ylanilino)ethane-1,1,1-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-propan-2-ylanilino)ethane-1,1,1-triol?
The IUPAC name of 2-(N-propan-2-ylanilino)ethane-1,1,1-triol (CID 54242870) is 2-(N-propan-2-ylanilino)ethane-1,1,1-triol.
What is the SMILES notation for 2-(N-propan-2-ylanilino)ethane-1,1,1-triol?
The canonical SMILES for 2-(N-propan-2-ylanilino)ethane-1,1,1-triol is CC(C)N(CC(O)(O)O)c1ccccc1.
What is the InChIKey of 2-(N-propan-2-ylanilino)ethane-1,1,1-triol?
The InChIKey is QRFRPAOUPOJJPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-9(2)12(8-11(13,14)15)10-6-4-3-5-7-10/h3-7,9,13-15H,8H2,1-2H3.
What are the key properties of 2-(N-propan-2-ylanilino)ethane-1,1,1-triol?
2-(N-propan-2-ylanilino)ethane-1,1,1-triol has a molecular weight of 211.26 g/mol, XLogP of 0.53, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-propan-2-ylanilino)ethane-1,1,1-triol is sourced from PubChem (CID 54242870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).