C25H31N3O5S — CID 54243435
2-[2-nitroso-2-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)ethyl]-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoic acid (PubChem CID 54243435) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is 2-[2-nitroso-2-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)ethyl]-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoic acid.
| Compound Name | 2-[2-nitroso-2-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)ethyl]-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 54243435 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2-[2-nitroso-2-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)ethyl]-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoic acid |
| SMILES | CN1C(=O)N(CCCC(CC(N=O)c2ccc3c4c(sc3c2)CCCC4)C(=O)O)C(=O)C1(C)C |
| InChI | InChI=1S/C25H31N3O5S/c1-25(2)23(31)28(24(32)27(25)3)12-6-7-16(22(29)30)13-19(26-33)15-10-11-18-17-8-4-5-9-20(17)34-21(18)14-15/h10-11,14,16,19H,4-9,12-13H2,1-3H3,(H,29,30) |
| InChIKey | QRPDFYYHFIUUNW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|