C17H18N4O7 — CID 54243685
N-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]-4-nitrobenzamide (PubChem CID 54243685) has the molecular formula C17H18N4O7 and a molecular weight of 390.35 g/mol. Its IUPAC name is N-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]-4-nitrobenzamide.
| Compound Name | N-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 54243685 |
| Molecular Formula | C17H18N4O7 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]-4-nitrobenzamide |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](CNC(=O)c3ccc([N+](=O)[O-])cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H18N4O7/c1-9-8-20(17(25)19-15(9)23)14-6-12(22)13(28-14)7-18-16(24)10-2-4-11(5-3-10)21(26)27/h2-5,8,12-14,22H,6-7H2,1H3,(H,18,24)(H,19,23,25)/t12-,13+,14+/m0/s1 |
| InChIKey | QRTREGCJFWKNRZ-BFHYXJOUSA-N |
| XLogP | -0.17 |
| TPSA | 156.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|