About (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide
(2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide (PubChem CID 54243970) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide |
| PubChem CID | 54243970 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide |
| SMILES | C[C@H](N)C(=O)NC1C=CC=CC1 |
| InChI | InChI=1S/C9H14N2O/c1-7(10)9(12)11-8-5-3-2-4-6-8/h2-5,7-8H,6,10H2,1H3,(H,11,12)/t7-,8?/m0/s1 |
| InChIKey | QRYDSWMPEIJBKY-JAMMHHFISA-N |
| XLogP | 0.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide?
The IUPAC name of (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide (CID 54243970) is (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide.
What is the SMILES notation for (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide?
The canonical SMILES for (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide is C[C@H](N)C(=O)NC1C=CC=CC1.
What is the InChIKey of (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide?
The InChIKey is QRYDSWMPEIJBKY-JAMMHHFISA-N. The full InChI is InChI=1S/C9H14N2O/c1-7(10)9(12)11-8-5-3-2-4-6-8/h2-5,7-8H,6,10H2,1H3,(H,11,12)/t7-,8?/m0/s1.
What are the key properties of (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide?
(2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide has a molecular weight of 166.22 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-cyclohexa-2,4-dien-1-ylpropanamide is sourced from PubChem (CID 54243970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).