C20H26Cl2N2O — CID 54244034
[(4aR,8S,8aS)-8-pyrrolidin-1-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3,4-dichlorophenyl)methanone (PubChem CID 54244034) has the molecular formula C20H26Cl2N2O and a molecular weight of 381.35 g/mol. Its IUPAC name is [(4aR,8S,8aS)-8-pyrrolidin-1-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3,4-dichlorophenyl)methanone.
| Compound Name | [(4aR,8S,8aS)-8-pyrrolidin-1-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 54244034 |
| Molecular Formula | C20H26Cl2N2O |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [(4aR,8S,8aS)-8-pyrrolidin-1-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCC[C@H]2CCC[C@H](N3CCCC3)[C@H]21 |
| InChI | InChI=1S/C20H26Cl2N2O/c21-16-9-8-15(13-17(16)22)20(25)24-12-4-6-14-5-3-7-18(19(14)24)23-10-1-2-11-23/h8-9,13-14,18-19H,1-7,10-12H2/t14-,18+,19+/m1/s1 |
| InChIKey | QRZCQQOJNIIGOU-CCKFTAQKSA-N |
| XLogP | 4.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |