About 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene
9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene (PubChem CID 54244186) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene.
Molecular Properties
| Compound Name | 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene |
| PubChem CID | 54244186 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene |
| SMILES | CC=C1CC2CC1C1=C2CC(C)CC1 |
| InChI | InChI=1S/C14H20/c1-3-10-7-11-8-14(10)12-5-4-9(2)6-13(11)12/h3,9,11,14H,4-8H2,1-2H3 |
| InChIKey | QSBVKZRVVFZMBD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene?
The IUPAC name of 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene (CID 54244186) is 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene.
What is the SMILES notation for 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene?
The canonical SMILES for 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene is CC=C1CC2CC1C1=C2CC(C)CC1.
What is the InChIKey of 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene?
The InChIKey is QSBVKZRVVFZMBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20/c1-3-10-7-11-8-14(10)12-5-4-9(2)6-13(11)12/h3,9,11,14H,4-8H2,1-2H3.
What are the key properties of 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene?
9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene has a molecular weight of 188.31 g/mol, XLogP of 4.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethylidene-4-methyltricyclo[6.2.1.02,7]undec-2(7)-ene is sourced from PubChem (CID 54244186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).