About (3R)-3-amino-N,4-dimethylpentanamide
(3R)-3-amino-N,4-dimethylpentanamide (PubChem CID 54244706) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is (3R)-3-amino-N,4-dimethylpentanamide.
Molecular Properties
| Compound Name | (3R)-3-amino-N,4-dimethylpentanamide |
| PubChem CID | 54244706 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | (3R)-3-amino-N,4-dimethylpentanamide |
| SMILES | CNC(=O)C[C@@H](N)C(C)C |
| InChI | InChI=1S/C7H16N2O/c1-5(2)6(8)4-7(10)9-3/h5-6H,4,8H2,1-3H3,(H,9,10)/t6-/m1/s1 |
| InChIKey | QSKZJEFNOWWNTR-ZCFIWIBFSA-N |
| XLogP | 0.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-amino-N,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-N,4-dimethylpentanamide?
The IUPAC name of (3R)-3-amino-N,4-dimethylpentanamide (CID 54244706) is (3R)-3-amino-N,4-dimethylpentanamide.
What is the SMILES notation for (3R)-3-amino-N,4-dimethylpentanamide?
The canonical SMILES for (3R)-3-amino-N,4-dimethylpentanamide is CNC(=O)C[C@@H](N)C(C)C.
What is the InChIKey of (3R)-3-amino-N,4-dimethylpentanamide?
The InChIKey is QSKZJEFNOWWNTR-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H16N2O/c1-5(2)6(8)4-7(10)9-3/h5-6H,4,8H2,1-3H3,(H,9,10)/t6-/m1/s1.
What are the key properties of (3R)-3-amino-N,4-dimethylpentanamide?
(3R)-3-amino-N,4-dimethylpentanamide has a molecular weight of 144.22 g/mol, XLogP of 0.11, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-N,4-dimethylpentanamide is sourced from PubChem (CID 54244706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).