About 3-(3,5-dihydroxyphenyl)prop-2-enal
3-(3,5-dihydroxyphenyl)prop-2-enal (PubChem CID 54245519) has the molecular formula C9H8O3
and a molecular weight of 164.16 g/mol. Its IUPAC name is 3-(3,5-dihydroxyphenyl)prop-2-enal.
Molecular Properties
| Compound Name | 3-(3,5-dihydroxyphenyl)prop-2-enal |
| PubChem CID | 54245519 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 3-(3,5-dihydroxyphenyl)prop-2-enal |
| SMILES | O=CC=Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C9H8O3/c10-3-1-2-7-4-8(11)6-9(12)5-7/h1-6,11-12H |
| InChIKey | QTQOGQXNGNAZFE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dihydroxyphenyl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dihydroxyphenyl)prop-2-enal?
The IUPAC name of 3-(3,5-dihydroxyphenyl)prop-2-enal (CID 54245519) is 3-(3,5-dihydroxyphenyl)prop-2-enal.
What is the SMILES notation for 3-(3,5-dihydroxyphenyl)prop-2-enal?
The canonical SMILES for 3-(3,5-dihydroxyphenyl)prop-2-enal is O=CC=Cc1cc(O)cc(O)c1.
What is the InChIKey of 3-(3,5-dihydroxyphenyl)prop-2-enal?
The InChIKey is QTQOGQXNGNAZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c10-3-1-2-7-4-8(11)6-9(12)5-7/h1-6,11-12H.
What are the key properties of 3-(3,5-dihydroxyphenyl)prop-2-enal?
3-(3,5-dihydroxyphenyl)prop-2-enal has a molecular weight of 164.16 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dihydroxyphenyl)prop-2-enal is sourced from PubChem (CID 54245519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).