About (2R)-pyrrolidine-1,2-diamine
(2R)-pyrrolidine-1,2-diamine (PubChem CID 54246028) has the molecular formula C4H11N3
and a molecular weight of 101.15 g/mol. Its IUPAC name is (2R)-pyrrolidine-1,2-diamine.
Molecular Properties
| Compound Name | (2R)-pyrrolidine-1,2-diamine |
| PubChem CID | 54246028 |
| Molecular Formula | C4H11N3 |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | (2R)-pyrrolidine-1,2-diamine |
| SMILES | N[C@H]1CCCN1N |
| InChI | InChI=1S/C4H11N3/c5-4-2-1-3-7(4)6/h4H,1-3,5-6H2/t4-/m1/s1 |
| InChIKey | QTIGIRGXJBYVTC-SCSAIBSYSA-N |
| XLogP | -0.76 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze (2R)-pyrrolidine-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-pyrrolidine-1,2-diamine?
The IUPAC name of (2R)-pyrrolidine-1,2-diamine (CID 54246028) is (2R)-pyrrolidine-1,2-diamine.
What is the SMILES notation for (2R)-pyrrolidine-1,2-diamine?
The canonical SMILES for (2R)-pyrrolidine-1,2-diamine is N[C@H]1CCCN1N.
What is the InChIKey of (2R)-pyrrolidine-1,2-diamine?
The InChIKey is QTIGIRGXJBYVTC-SCSAIBSYSA-N. The full InChI is InChI=1S/C4H11N3/c5-4-2-1-3-7(4)6/h4H,1-3,5-6H2/t4-/m1/s1.
What are the key properties of (2R)-pyrrolidine-1,2-diamine?
(2R)-pyrrolidine-1,2-diamine has a molecular weight of 101.15 g/mol, XLogP of -0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-pyrrolidine-1,2-diamine is sourced from PubChem (CID 54246028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).