About (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate
(2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate (PubChem CID 54246213) has the molecular formula C13H19NO6S
and a molecular weight of 317.36 g/mol. Its IUPAC name is (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate.
Molecular Properties
| Compound Name | (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate |
| PubChem CID | 54246213 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate |
| SMILES | CCOC1Oc2ccc(OS(=O)(=O)ONC)cc2C1(C)C |
| InChI | InChI=1S/C13H19NO6S/c1-5-17-12-13(2,3)10-8-9(6-7-11(10)18-12)19-21(15,16)20-14-4/h6-8,12,14H,5H2,1-4H3 |
| InChIKey | QTLIPOVDMOEWKP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate?
The IUPAC name of (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate (CID 54246213) is (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate.
What is the SMILES notation for (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate?
The canonical SMILES for (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate is CCOC1Oc2ccc(OS(=O)(=O)ONC)cc2C1(C)C.
What is the InChIKey of (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate?
The InChIKey is QTLIPOVDMOEWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO6S/c1-5-17-12-13(2,3)10-8-9(6-7-11(10)18-12)19-21(15,16)20-14-4/h6-8,12,14H,5H2,1-4H3.
What are the key properties of (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate?
(2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate has a molecular weight of 317.36 g/mol, XLogP of 1.49, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methylamino sulfate is sourced from PubChem (CID 54246213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).