About 2,3-dihydropyridine-3,5-dicarboxylic acid
2,3-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 54246370) has the molecular formula C7H7NO4
and a molecular weight of 169.14 g/mol. Its IUPAC name is 2,3-dihydropyridine-3,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 2,3-dihydropyridine-3,5-dicarboxylic acid |
| PubChem CID | 54246370 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 2,3-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | O=C(O)C1=CC(C(=O)O)CN=C1 |
| InChI | InChI=1S/C7H7NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-2,5H,3H2,(H,9,10)(H,11,12) |
| InChIKey | QTODKCBHAPRUDF-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydropyridine-3,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydropyridine-3,5-dicarboxylic acid?
The IUPAC name of 2,3-dihydropyridine-3,5-dicarboxylic acid (CID 54246370) is 2,3-dihydropyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 2,3-dihydropyridine-3,5-dicarboxylic acid?
The canonical SMILES for 2,3-dihydropyridine-3,5-dicarboxylic acid is O=C(O)C1=CC(C(=O)O)CN=C1.
What is the InChIKey of 2,3-dihydropyridine-3,5-dicarboxylic acid?
The InChIKey is QTODKCBHAPRUDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-2,5H,3H2,(H,9,10)(H,11,12).
What are the key properties of 2,3-dihydropyridine-3,5-dicarboxylic acid?
2,3-dihydropyridine-3,5-dicarboxylic acid has a molecular weight of 169.14 g/mol, XLogP of -0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydropyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 54246370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).