C45H60N2O7 — CID 54246375
[(2R,3S,5R,6R)-6-(6-aminohexoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylbutanoate (PubChem CID 54246375) has the molecular formula C45H60N2O7 and a molecular weight of 740.98 g/mol. Its IUPAC name is [(2R,3S,5R,6R)-6-(6-aminohexoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylbutanoate.
| Compound Name | [(2R,3S,5R,6R)-6-(6-aminohexoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylbutanoate |
|---|---|
| PubChem CID | 54246375 |
| Molecular Formula | C45H60N2O7 |
| Molecular Weight | 740.98 g/mol |
| Exact Mass | 740.44 |
| IUPAC Name | [(2R,3S,5R,6R)-6-(6-aminohexoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylbutanoate |
| SMILES | CC(c1ccccc1)C(C)(C)C(=O)O[C@H]1C[C@@H](OC(=O)C(C)(C)Cc2ccccc2)[C@](CCc2c[nH]c3ccccc23)(OCCCCCCN)O[C@@H]1CO |
| InChI | InChI=1S/C45H60N2O7/c1-32(34-20-12-9-13-21-34)44(4,5)42(50)52-38-28-40(53-41(49)43(2,3)29-33-18-10-8-11-19-33)45(54-39(38)31-48,51-27-17-7-6-16-26-46)25-24-35-30-47-37-23-15-14-22-36(35)37/h8-15,18-23,30,32,38-40,47-48H,6-7,16-17,24-29,31,46H2,1-5H3/t32?,38-,39+,40+,45+/m0/s1 |
| InChIKey | QTOIPJZASHWJPU-RXMSWCGXSA-N |
| XLogP | 8.04 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.98 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|