C16H27NO3 — CID 54246756
4,11-dihydroxy-N,N,12-trimethyltrideca-5,7,9-trienamide (PubChem CID 54246756) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 4,11-dihydroxy-N,N,12-trimethyltrideca-5,7,9-trienamide.
| Compound Name | 4,11-dihydroxy-N,N,12-trimethyltrideca-5,7,9-trienamide |
|---|---|
| PubChem CID | 54246756 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 4,11-dihydroxy-N,N,12-trimethyltrideca-5,7,9-trienamide |
| SMILES | CC(C)C(O)C=CC=CC=CC(O)CCC(=O)N(C)C |
| InChI | InChI=1S/C16H27NO3/c1-13(2)15(19)10-8-6-5-7-9-14(18)11-12-16(20)17(3)4/h5-10,13-15,18-19H,11-12H2,1-4H3 |
| InChIKey | QTUNJWYJGVAZNQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|