C7H12N+ — CID 54246966
1,2,3-trimethyl-3H-pyrrol-1-ium (PubChem CID 54246966) has the molecular formula C7H12N+ and a molecular weight of 110.18 g/mol. Its IUPAC name is 1,2,3-trimethyl-3H-pyrrol-1-ium.
| Compound Name | 1,2,3-trimethyl-3H-pyrrol-1-ium |
|---|---|
| PubChem CID | 54246966 |
| Molecular Formula | C7H12N+ |
| Molecular Weight | 110.18 g/mol |
| Exact Mass | 110.10 |
| IUPAC Name | 1,2,3-trimethyl-3H-pyrrol-1-ium |
| SMILES | CC1=[N+](C)C=CC1C |
| InChI | InChI=1S/C7H12N/c1-6-4-5-8(3)7(6)2/h4-6H,1-3H3/q+1 |
| InChIKey | QTYFGBKWVXWZGU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|