About N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide
N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide (PubChem CID 54247237) has the molecular formula C20H14N2O3
and a molecular weight of 330.34 g/mol. Its IUPAC name is N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide.
Molecular Properties
| Compound Name | N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide |
| PubChem CID | 54247237 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide |
| SMILES | CN(C(=O)c1cccc2ccccc12)c1nc2ccccc2c(=O)o1 |
| InChI | InChI=1S/C20H14N2O3/c1-22(20-21-17-12-5-4-10-16(17)19(24)25-20)18(23)15-11-6-8-13-7-2-3-9-14(13)15/h2-12H,1H3 |
| InChIKey | QUDAUBHHQJSPNJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide?
The IUPAC name of N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide (CID 54247237) is N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide.
What is the SMILES notation for N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide?
The canonical SMILES for N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide is CN(C(=O)c1cccc2ccccc12)c1nc2ccccc2c(=O)o1.
What is the InChIKey of N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide?
The InChIKey is QUDAUBHHQJSPNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O3/c1-22(20-21-17-12-5-4-10-16(17)19(24)25-20)18(23)15-11-6-8-13-7-2-3-9-14(13)15/h2-12H,1H3.
What are the key properties of N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide?
N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide has a molecular weight of 330.34 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)naphthalene-1-carboxamide is sourced from PubChem (CID 54247237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).