About O-ethyl but-3-enethioate
O-ethyl but-3-enethioate (PubChem CID 54247260) has the molecular formula C6H10OS
and a molecular weight of 130.21 g/mol. Its IUPAC name is O-ethyl but-3-enethioate.
Molecular Properties
| Compound Name | O-ethyl but-3-enethioate |
| PubChem CID | 54247260 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | O-ethyl but-3-enethioate |
| SMILES | C=CCC(=S)OCC |
| InChI | InChI=1S/C6H10OS/c1-3-5-6(8)7-4-2/h3H,1,4-5H2,2H3 |
| InChIKey | QUDLNJZPZYFVRT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethyl but-3-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethyl but-3-enethioate?
The IUPAC name of O-ethyl but-3-enethioate (CID 54247260) is O-ethyl but-3-enethioate.
What is the SMILES notation for O-ethyl but-3-enethioate?
The canonical SMILES for O-ethyl but-3-enethioate is C=CCC(=S)OCC.
What is the InChIKey of O-ethyl but-3-enethioate?
The InChIKey is QUDLNJZPZYFVRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS/c1-3-5-6(8)7-4-2/h3H,1,4-5H2,2H3.
What are the key properties of O-ethyl but-3-enethioate?
O-ethyl but-3-enethioate has a molecular weight of 130.21 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethyl but-3-enethioate is sourced from PubChem (CID 54247260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).