About methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate
methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 54247289) has the molecular formula C15H21NO5S
and a molecular weight of 327.40 g/mol. Its IUPAC name is methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate |
| PubChem CID | 54247289 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | CCCCS(=O)(=O)Nc1ccc2c(c1)CCC(C(=O)OC)O2 |
| InChI | InChI=1S/C15H21NO5S/c1-3-4-9-22(18,19)16-12-6-8-13-11(10-12)5-7-14(21-13)15(17)20-2/h6,8,10,14,16H,3-5,7,9H2,1-2H3 |
| InChIKey | QUDVZELMGOXMFM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate?
The IUPAC name of methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate (CID 54247289) is methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate.
What is the SMILES notation for methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate?
The canonical SMILES for methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate is CCCCS(=O)(=O)Nc1ccc2c(c1)CCC(C(=O)OC)O2.
What is the InChIKey of methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate?
The InChIKey is QUDVZELMGOXMFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO5S/c1-3-4-9-22(18,19)16-12-6-8-13-11(10-12)5-7-14(21-13)15(17)20-2/h6,8,10,14,16H,3-5,7,9H2,1-2H3.
What are the key properties of methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate?
methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate has a molecular weight of 327.40 g/mol, XLogP of 2.10, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(butylsulfonylamino)-3,4-dihydro-2H-chromene-2-carboxylate is sourced from PubChem (CID 54247289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).