About 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol
3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol (PubChem CID 54247480) has the molecular formula C12H10BrF2NO2
and a molecular weight of 318.12 g/mol. Its IUPAC name is 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol |
| PubChem CID | 54247480 |
| Molecular Formula | C12H10BrF2NO2 |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol |
| SMILES | Cc1cc(-n2c(O)cc(CBr)c2O)c(F)cc1F |
| InChI | InChI=1S/C12H10BrF2NO2/c1-6-2-10(9(15)4-8(6)14)16-11(17)3-7(5-13)12(16)18/h2-4,17-18H,5H2,1H3 |
| InChIKey | QUHFUXDWBOVTKA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol?
The IUPAC name of 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol (CID 54247480) is 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol.
What is the SMILES notation for 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol?
The canonical SMILES for 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol is Cc1cc(-n2c(O)cc(CBr)c2O)c(F)cc1F.
What is the InChIKey of 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol?
The InChIKey is QUHFUXDWBOVTKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrF2NO2/c1-6-2-10(9(15)4-8(6)14)16-11(17)3-7(5-13)12(16)18/h2-4,17-18H,5H2,1H3.
What are the key properties of 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol?
3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol has a molecular weight of 318.12 g/mol, XLogP of 3.37, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-1-(2,4-difluoro-5-methylphenyl)pyrrole-2,5-diol is sourced from PubChem (CID 54247480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).