About [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate
[3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate (PubChem CID 54247537) has the molecular formula C27H20Cl2N2O4
and a molecular weight of 507.37 g/mol. Its IUPAC name is [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate.
Molecular Properties
| Compound Name | [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate |
| PubChem CID | 54247537 |
| Molecular Formula | C27H20Cl2N2O4 |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate |
| SMILES | Cc1c(NC(=O)CCc2ccc(Cl)cc2Cl)c(=O)nc2ccccc2c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H20Cl2N2O4/c1-16-24(31-23(32)14-12-17-11-13-19(28)15-21(17)29)26(33)30-22-10-6-5-9-20(22)25(16)35-27(34)18-7-3-2-4-8-18/h2-11,13,15H,12,14H2,1H3,(H,30,31,32,33) |
| InChIKey | QUIIUDABOWMAOL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate?
The IUPAC name of [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate (CID 54247537) is [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate.
What is the SMILES notation for [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate?
The canonical SMILES for [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate is Cc1c(NC(=O)CCc2ccc(Cl)cc2Cl)c(=O)nc2ccccc2c1OC(=O)c1ccccc1.
What is the InChIKey of [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate?
The InChIKey is QUIIUDABOWMAOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20Cl2N2O4/c1-16-24(31-23(32)14-12-17-11-13-19(28)15-21(17)29)26(33)30-22-10-6-5-9-20(22)25(16)35-27(34)18-7-3-2-4-8-18/h2-11,13,15H,12,14H2,1H3,(H,30,31,32,33).
What are the key properties of [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate?
[3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate has a molecular weight of 507.37 g/mol, XLogP of 6.00, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(2,4-dichlorophenyl)propanoylamino]-4-methyl-2-oxo-1-benzazepin-5-yl] benzoate is sourced from PubChem (CID 54247537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).