C49H32F6O6 — CID 54247547
3-(4-methoxyphenyl)-1-[7-[3-(4-methoxyphenyl)prop-2-enoyl]-9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]prop-2-en-1-one (PubChem CID 54247547) has the molecular formula C49H32F6O6 and a molecular weight of 830.78 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-[7-[3-(4-methoxyphenyl)prop-2-enoyl]-9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]prop-2-en-1-one.
| Compound Name | 3-(4-methoxyphenyl)-1-[7-[3-(4-methoxyphenyl)prop-2-enoyl]-9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 54247547 |
| Molecular Formula | C49H32F6O6 |
| Molecular Weight | 830.78 g/mol |
| Exact Mass | 830.21 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-[7-[3-(4-methoxyphenyl)prop-2-enoyl]-9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2ccc3c(c2)C(c2ccc(OC(F)=C(F)F)cc2)(c2ccc(OC(F)=C(F)F)cc2)c2cc(C(=O)C=Cc4ccc(OC)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C49H32F6O6/c1-58-35-15-3-29(4-16-35)7-25-43(56)31-9-23-39-40-24-10-32(44(57)26-8-30-5-17-36(59-2)18-6-30)28-42(40)49(41(39)27-31,33-11-19-37(20-12-33)60-47(54)45(50)51)34-13-21-38(22-14-34)61-48(55)46(52)53/h3-28H,1-2H3 |
| InChIKey | QUILGQUQIQFDLC-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.78 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|