C22H36O4 — CID 54248194
diethyl 2-(3,7,11-trimethyldodeca-2,6,10-trienyl)propanedioate (PubChem CID 54248194) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is diethyl 2-(3,7,11-trimethyldodeca-2,6,10-trienyl)propanedioate.
| Compound Name | diethyl 2-(3,7,11-trimethyldodeca-2,6,10-trienyl)propanedioate |
|---|---|
| PubChem CID | 54248194 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | diethyl 2-(3,7,11-trimethyldodeca-2,6,10-trienyl)propanedioate |
| SMILES | CCOC(=O)C(CC=C(C)CCC=C(C)CCC=C(C)C)C(=O)OCC |
| InChI | InChI=1S/C22H36O4/c1-7-25-21(23)20(22(24)26-8-2)16-15-19(6)14-10-13-18(5)12-9-11-17(3)4/h11,13,15,20H,7-10,12,14,16H2,1-6H3 |
| InChIKey | QUUZZWDEXJOMTE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|