C15H25N3 — CID 54248879
(4S,8aS)-8-[(2S)-1-azidopropan-2-yl]-4,8a-dimethyl-2,3,4,4a,5,6-hexahydro-1H-naphthalene (PubChem CID 54248879) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (4S,8aS)-8-[(2S)-1-azidopropan-2-yl]-4,8a-dimethyl-2,3,4,4a,5,6-hexahydro-1H-naphthalene.
| Compound Name | (4S,8aS)-8-[(2S)-1-azidopropan-2-yl]-4,8a-dimethyl-2,3,4,4a,5,6-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 54248879 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (4S,8aS)-8-[(2S)-1-azidopropan-2-yl]-4,8a-dimethyl-2,3,4,4a,5,6-hexahydro-1H-naphthalene |
| SMILES | C[C@H](CN=[N+]=[N-])C1=CCCC2[C@@H](C)CCC[C@]12C |
| InChI | InChI=1S/C15H25N3/c1-11-6-5-9-15(3)13(11)7-4-8-14(15)12(2)10-17-18-16/h8,11-13H,4-7,9-10H2,1-3H3/t11-,12+,13?,15-/m0/s1 |
| InChIKey | QVHNZCFQGYJUBL-YOOVYSLHSA-N |
| XLogP | 5.10 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|