C19H16Cl2N2O2 — CID 54249071
4,5-bis(4-chlorophenyl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine (PubChem CID 54249071) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine.
| Compound Name | 4,5-bis(4-chlorophenyl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine |
|---|---|
| PubChem CID | 54249071 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine |
| SMILES | CC1=NC(C)=C(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)C1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-11-17(13-3-7-15(20)8-4-13)18(14-5-9-16(21)10-6-14)19(23(24)25)12(2)22-11/h3-10,18-19H,1-2H3 |
| InChIKey | QVLJRSOAYVNJSW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|