C16H26N2O3 — CID 54249280
tert-butyl (3aS,4S)-4-(acetamidomethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate (PubChem CID 54249280) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is tert-butyl (3aS,4S)-4-(acetamidomethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl (3aS,4S)-4-(acetamidomethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 54249280 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | tert-butyl (3aS,4S)-4-(acetamidomethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate |
| SMILES | CC(=O)NC[C@H]1CC=CC2CN(C(=O)OC(C)(C)C)C[C@H]21 |
| InChI | InChI=1S/C16H26N2O3/c1-11(19)17-8-12-6-5-7-13-9-18(10-14(12)13)15(20)21-16(2,3)4/h5,7,12-14H,6,8-10H2,1-4H3,(H,17,19)/t12-,13?,14+/m1/s1 |
| InChIKey | QVPCAUROVNPSAR-YIOYIWSBSA-N |
| XLogP | 2.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|