C11H21N3OSi — CID 54249860
[3,3-dimethyl-1-(1,2,4-triazol-1-yl)but-1-en-2-yl]oxy-trimethylsilane (PubChem CID 54249860) has the molecular formula C11H21N3OSi and a molecular weight of 239.40 g/mol. Its IUPAC name is [3,3-dimethyl-1-(1,2,4-triazol-1-yl)but-1-en-2-yl]oxy-trimethylsilane.
| Compound Name | [3,3-dimethyl-1-(1,2,4-triazol-1-yl)but-1-en-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 54249860 |
| Molecular Formula | C11H21N3OSi |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [3,3-dimethyl-1-(1,2,4-triazol-1-yl)but-1-en-2-yl]oxy-trimethylsilane |
| SMILES | CC(C)(C)C(=Cn1cncn1)O[Si](C)(C)C |
| InChI | InChI=1S/C11H21N3OSi/c1-11(2,3)10(15-16(4,5)6)7-14-9-12-8-13-14/h7-9H,1-6H3 |
| InChIKey | QVZJPSQGHPNURJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|