About N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide
N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide (PubChem CID 54250230) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide.
Molecular Properties
| Compound Name | N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide |
| PubChem CID | 54250230 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide |
| SMILES | CCC(=Nc1[nH]ncc1C)NO |
| InChI | InChI=1S/C7H12N4O/c1-3-6(11-12)9-7-5(2)4-8-10-7/h4,12H,3H2,1-2H3,(H2,8,9,10,11) |
| InChIKey | QWFSYWSKAMTGJU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide?
The IUPAC name of N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide (CID 54250230) is N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide.
What is the SMILES notation for N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide?
The canonical SMILES for N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide is CCC(=Nc1[nH]ncc1C)NO.
What is the InChIKey of N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide?
The InChIKey is QWFSYWSKAMTGJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c1-3-6(11-12)9-7-5(2)4-8-10-7/h4,12H,3H2,1-2H3,(H2,8,9,10,11).
What are the key properties of N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide?
N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide has a molecular weight of 168.20 g/mol, XLogP of 1.14, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N'-(4-methyl-1H-pyrazol-5-yl)propanimidamide is sourced from PubChem (CID 54250230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).