About 6-iminoheptan-1-amine
6-iminoheptan-1-amine (PubChem CID 54250278) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is 6-iminoheptan-1-amine.
Molecular Properties
| Compound Name | 6-iminoheptan-1-amine |
| PubChem CID | 54250278 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 6-iminoheptan-1-amine |
| SMILES | [H]/N=C(\C)CCCCCN |
| InChI | InChI=1S/C7H16N2/c1-7(9)5-3-2-4-6-8/h9H,2-6,8H2,1H3/b9-7+ |
| InChIKey | QWGMLGPMXRBJNF-VQHVLOKHSA-N |
| XLogP | 1.55 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-iminoheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iminoheptan-1-amine?
The IUPAC name of 6-iminoheptan-1-amine (CID 54250278) is 6-iminoheptan-1-amine.
What is the SMILES notation for 6-iminoheptan-1-amine?
The canonical SMILES for 6-iminoheptan-1-amine is [H]/N=C(\C)CCCCCN.
What is the InChIKey of 6-iminoheptan-1-amine?
The InChIKey is QWGMLGPMXRBJNF-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H16N2/c1-7(9)5-3-2-4-6-8/h9H,2-6,8H2,1H3/b9-7+.
What are the key properties of 6-iminoheptan-1-amine?
6-iminoheptan-1-amine has a molecular weight of 128.22 g/mol, XLogP of 1.55, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iminoheptan-1-amine is sourced from PubChem (CID 54250278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).