C16H21N5O3 — CID 54250487
1-(3,4-diethoxyphenyl)-4-(2-prop-2-enylhydrazinyl)-1,3,5-triazin-2-one (PubChem CID 54250487) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-4-(2-prop-2-enylhydrazinyl)-1,3,5-triazin-2-one.
| Compound Name | 1-(3,4-diethoxyphenyl)-4-(2-prop-2-enylhydrazinyl)-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 54250487 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-4-(2-prop-2-enylhydrazinyl)-1,3,5-triazin-2-one |
| SMILES | C=CCNNc1ncn(-c2ccc(OCC)c(OCC)c2)c(=O)n1 |
| InChI | InChI=1S/C16H21N5O3/c1-4-9-18-20-15-17-11-21(16(22)19-15)12-7-8-13(23-5-2)14(10-12)24-6-3/h4,7-8,10-11,18H,1,5-6,9H2,2-3H3,(H,19,20,22) |
| InChIKey | QWJPQJAXQKEWIY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|