About 2-O-chloro 1-O-phenyl oxalate
2-O-chloro 1-O-phenyl oxalate (PubChem CID 54251565) has the molecular formula C8H5ClO4
and a molecular weight of 200.58 g/mol. Its IUPAC name is 2-O-chloro 1-O-phenyl oxalate.
Molecular Properties
| Compound Name | 2-O-chloro 1-O-phenyl oxalate |
| PubChem CID | 54251565 |
| Molecular Formula | C8H5ClO4 |
| Molecular Weight | 200.58 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 2-O-chloro 1-O-phenyl oxalate |
| SMILES | O=C(OCl)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C8H5ClO4/c9-13-8(11)7(10)12-6-4-2-1-3-5-6/h1-5H |
| InChIKey | QXCMGPBUKIMFQM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.58 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-O-chloro 1-O-phenyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-chloro 1-O-phenyl oxalate?
The IUPAC name of 2-O-chloro 1-O-phenyl oxalate (CID 54251565) is 2-O-chloro 1-O-phenyl oxalate.
What is the SMILES notation for 2-O-chloro 1-O-phenyl oxalate?
The canonical SMILES for 2-O-chloro 1-O-phenyl oxalate is O=C(OCl)C(=O)Oc1ccccc1.
What is the InChIKey of 2-O-chloro 1-O-phenyl oxalate?
The InChIKey is QXCMGPBUKIMFQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClO4/c9-13-8(11)7(10)12-6-4-2-1-3-5-6/h1-5H.
What are the key properties of 2-O-chloro 1-O-phenyl oxalate?
2-O-chloro 1-O-phenyl oxalate has a molecular weight of 200.58 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-chloro 1-O-phenyl oxalate is sourced from PubChem (CID 54251565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).