About 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole
2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole (PubChem CID 54251704) has the molecular formula C5H4ClF2NS
and a molecular weight of 183.61 g/mol. Its IUPAC name is 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole |
| PubChem CID | 54251704 |
| Molecular Formula | C5H4ClF2NS |
| Molecular Weight | 183.61 g/mol |
| Exact Mass | 182.97 |
| IUPAC Name | 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole |
| SMILES | FC(F)Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C5H4ClF2NS/c6-5-9-2-3(10-5)1-4(7)8/h2,4H,1H2 |
| InChIKey | GYTMBKGRLMZHCA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole?
The IUPAC name of 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole (CID 54251704) is 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole.
What is the SMILES notation for 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole?
The canonical SMILES for 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole is FC(F)Cc1cnc(Cl)s1.
What is the InChIKey of 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole?
The InChIKey is GYTMBKGRLMZHCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClF2NS/c6-5-9-2-3(10-5)1-4(7)8/h2,4H,1H2.
What are the key properties of 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole?
2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole has a molecular weight of 183.61 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(2,2-difluoroethyl)-1,3-thiazole is sourced from PubChem (CID 54251704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).